C16H14N2O3 — CID 4107156
2-cyano-N-(2-methoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 4107156) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-cyano-N-(2-methoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(2-methoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4107156 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-cyano-N-(2-methoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)C(C#N)=Cc1ccc(C)o1 |
| InChI | InChI=1S/C16H14N2O3/c1-11-7-8-13(21-11)9-12(10-17)16(19)18-14-5-3-4-6-15(14)20-2/h3-9H,1-2H3,(H,18,19) |
| InChIKey | PPRGJGGQQFLDSE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|