C31H27N3O6S — CID 4662350
ethyl 4-[5-[2-cyano-3-[4-[(2,6-dimethylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 4662350) has the molecular formula C31H27N3O6S and a molecular weight of 569.64 g/mol. Its IUPAC name is ethyl 4-[5-[2-cyano-3-[4-[(2,6-dimethylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[2-cyano-3-[4-[(2,6-dimethylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4662350 |
| Molecular Formula | C31H27N3O6S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | ethyl 4-[5-[2-cyano-3-[4-[(2,6-dimethylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C(C#N)C(=O)Nc3ccc(S(=O)(=O)Nc4c(C)cccc4C)cc3)o2)cc1 |
| InChI | InChI=1S/C31H27N3O6S/c1-4-39-31(36)23-10-8-22(9-11-23)28-17-14-26(40-28)18-24(19-32)30(35)33-25-12-15-27(16-13-25)41(37,38)34-29-20(2)6-5-7-21(29)3/h5-18,34H,4H2,1-3H3,(H,33,35) |
| InChIKey | GFRJDSVOUIJIDA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|