C15H9N3OS2 — CID 943829
(Z)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyanoprop-2-enethioamide (PubChem CID 943829) has the molecular formula C15H9N3OS2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (Z)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyanoprop-2-enethioamide.
| Compound Name | (Z)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 943829 |
| Molecular Formula | C15H9N3OS2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (Z)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyanoprop-2-enethioamide |
| SMILES | N#C/C(=C/c1ccc(-c2nc3ccccc3s2)o1)C(N)=S |
| InChI | InChI=1S/C15H9N3OS2/c16-8-9(14(17)20)7-10-5-6-12(19-10)15-18-11-3-1-2-4-13(11)21-15/h1-7H,(H2,17,20)/b9-7- |
| InChIKey | DCGNIODAIUWLIW-CLFYSBASSA-N |
| XLogP | 3.75 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|