C20H12N2O3S — CID 9366605
(E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile (PubChem CID 9366605) has the molecular formula C20H12N2O3S and a molecular weight of 360.39 g/mol. Its IUPAC name is (E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9366605 |
| Molecular Formula | C20H12N2O3S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1occc1C(=O)/C(C#N)=C/c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C20H12N2O3S/c1-12-15(8-9-24-12)19(23)13(11-21)10-14-6-7-17(25-14)20-22-16-4-2-3-5-18(16)26-20/h2-10H,1H3/b13-10+ |
| InChIKey | SNBRECPARBWTBG-JLHYYAGUSA-N |
| XLogP | 5.25 |
| TPSA | 80.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|