C21H14N4O4S2 — CID 74671446
3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyano-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 74671446) has the molecular formula C21H14N4O4S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyano-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyano-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74671446 |
| Molecular Formula | C21H14N4O4S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-cyano-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2nc3ccccc3s2)o1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H14N4O4S2/c22-12-13(20(26)24-14-5-8-16(9-6-14)31(23,27)28)11-15-7-10-18(29-15)21-25-17-3-1-2-4-19(17)30-21/h1-11H,(H,24,26)(H2,23,27,28) |
| InChIKey | UBMNNFBJKMPIQA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|