C18H13N3O3S3 — CID 4586039
5-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)thiophene-2-carboxamide (PubChem CID 4586039) has the molecular formula C18H13N3O3S3 and a molecular weight of 415.52 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4586039 |
| Molecular Formula | C18H13N3O3S3 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc(-c3nc4ccccc4s3)s2)cc1 |
| InChI | InChI=1S/C18H13N3O3S3/c19-27(23,24)12-7-5-11(6-8-12)20-17(22)15-9-10-16(25-15)18-21-13-3-1-2-4-14(13)26-18/h1-10H,(H,20,22)(H2,19,23,24) |
| InChIKey | VUPLAPJNLVTRMM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |