C19H11N3OS3 — CID 5102836
N,5-bis(1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 5102836) has the molecular formula C19H11N3OS3 and a molecular weight of 393.52 g/mol. Its IUPAC name is N,5-bis(1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N,5-bis(1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5102836 |
| Molecular Formula | C19H11N3OS3 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | N,5-bis(1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc(-c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C19H11N3OS3/c23-17(22-19-21-12-6-2-4-8-14(12)26-19)15-9-10-16(24-15)18-20-11-5-1-3-7-13(11)25-18/h1-10H,(H,21,22,23) |
| InChIKey | WMUGSDKUDSTNHN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |