C21H12N4OS — CID 2958139
2-(1H-benzimidazol-2-yl)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enenitrile (PubChem CID 2958139) has the molecular formula C21H12N4OS and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2958139 |
| Molecular Formula | C21H12N4OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2nc3ccccc3s2)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H12N4OS/c22-12-13(20-23-15-5-1-2-6-16(15)24-20)11-14-9-10-18(26-14)21-25-17-7-3-4-8-19(17)27-21/h1-11H,(H,23,24) |
| InChIKey | YZVCFCIQLNDVML-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|