C21H13N3O3 — CID 5286533
3-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid (PubChem CID 5286533) has the molecular formula C21H13N3O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 5286533 |
| Molecular Formula | C21H13N3O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2cccc(C(=O)O)c2)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H13N3O3/c22-12-15(20-23-17-6-1-2-7-18(17)24-20)11-16-8-9-19(27-16)13-4-3-5-14(10-13)21(25)26/h1-11H,(H,23,24)(H,25,26)/b15-11+ |
| InChIKey | FULNFOCEYITKTH-RVDMUPIBSA-N |
| XLogP | 4.59 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|