C15H9F6NO3 — CID 6085872
2-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-2-nitroprop-1-enyl]furan (PubChem CID 6085872) has the molecular formula C15H9F6NO3 and a molecular weight of 365.23 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-2-nitroprop-1-enyl]furan.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-2-nitroprop-1-enyl]furan |
|---|---|
| PubChem CID | 6085872 |
| Molecular Formula | C15H9F6NO3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-2-nitroprop-1-enyl]furan |
| SMILES | C/C(=C\c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H9F6NO3/c1-8(22(23)24)4-12-2-3-13(25-12)9-5-10(14(16,17)18)7-11(6-9)15(19,20)21/h2-7H,1H3/b8-4+ |
| InChIKey | WOPOTSLUAZDOBB-XBXARRHUSA-N |
| XLogP | 5.62 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|