C21H11Cl3N2O4 — CID 3748048
4-chloro-3-[5-[2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 3748048) has the molecular formula C21H11Cl3N2O4 and a molecular weight of 461.69 g/mol. Its IUPAC name is 4-chloro-3-[5-[2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3748048 |
| Molecular Formula | C21H11Cl3N2O4 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 4-chloro-3-[5-[2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | N#CC(=Cc1ccc(-c2cc(C(=O)O)ccc2Cl)o1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H11Cl3N2O4/c22-16-4-1-11(21(28)29)8-15(16)19-6-3-14(30-19)7-12(10-25)20(27)26-13-2-5-17(23)18(24)9-13/h1-9H,(H,26,27)(H,28,29) |
| InChIKey | LSULTPMAJBIVDX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|