C18H16Cl2N2O2 — CID 1120860
(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N,N-diethylprop-2-enamide (PubChem CID 1120860) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N,N-diethylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 1120860 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-3-22(4-2)18(23)12(11-21)9-14-6-8-17(24-14)15-10-13(19)5-7-16(15)20/h5-10H,3-4H2,1-2H3/b12-9+ |
| InChIKey | XEGPCZZJFKVXCC-FMIVXFBMSA-N |
| XLogP | 5.03 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|