C18H17BrN2O2 — CID 1050401
(E)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N,N-diethylprop-2-enamide (PubChem CID 1050401) has the molecular formula C18H17BrN2O2 and a molecular weight of 373.25 g/mol. Its IUPAC name is (E)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 1050401 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C18H17BrN2O2/c1-3-21(4-2)18(22)14(12-20)11-16-9-10-17(23-16)13-5-7-15(19)8-6-13/h5-11H,3-4H2,1-2H3/b14-11+ |
| InChIKey | HTMNEXFGFHAMGC-SDNWHVSQSA-N |
| XLogP | 4.48 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|