About pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate
pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate (PubChem CID 22300232) has the molecular formula C19H12BrN2O3+
and a molecular weight of 396.22 g/mol. Its IUPAC name is pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate |
| PubChem CID | 22300232 |
| Molecular Formula | C19H12BrN2O3+ |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(Br)cc2)o1)C(=O)O[n+]1ccccc1 |
| InChI | InChI=1S/C19H12BrN2O3/c20-16-6-4-14(5-7-16)18-9-8-17(24-18)12-15(13-21)19(23)25-22-10-2-1-3-11-22/h1-12H/q+1/b15-12- |
| InChIKey | BZXPJDIDXZJWMC-QINSGFPZSA-N |
| XLogP | 3.56 |
| TPSA | 67.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate?
The IUPAC name of pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate (CID 22300232) is pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate.
What is the SMILES notation for pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate?
The canonical SMILES for pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate is N#C/C(=C/c1ccc(-c2ccc(Br)cc2)o1)C(=O)O[n+]1ccccc1.
What is the InChIKey of pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate?
The InChIKey is BZXPJDIDXZJWMC-QINSGFPZSA-N. The full InChI is InChI=1S/C19H12BrN2O3/c20-16-6-4-14(5-7-16)18-9-8-17(24-18)12-15(13-21)19(23)25-22-10-2-1-3-11-22/h1-12H/q+1/b15-12-.
What are the key properties of pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate?
pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate has a molecular weight of 396.22 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-yl (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoate is sourced from PubChem (CID 22300232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).