C14H6Cl2O5-2 — CID 7430807
2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]propanedioate (PubChem CID 7430807) has the molecular formula C14H6Cl2O5-2 and a molecular weight of 325.10 g/mol. Its IUPAC name is 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]propanedioate.
| Compound Name | 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 7430807 |
| Molecular Formula | C14H6Cl2O5-2 |
| Molecular Weight | 325.10 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]propanedioate |
| SMILES | O=C([O-])C(=Cc1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)[O-] |
| InChI | InChI=1S/C14H8Cl2O5/c15-7-1-3-11(16)9(5-7)12-4-2-8(21-12)6-10(13(17)18)14(19)20/h1-6H,(H,17,18)(H,19,20)/p-2 |
| InChIKey | MCAULKHIXAMDFI-UHFFFAOYSA-L |
| XLogP | 1.14 |
| TPSA | 93.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|