C13H8Cl2O3S — CID 43839856
(Z)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid (PubChem CID 43839856) has the molecular formula C13H8Cl2O3S and a molecular weight of 315.18 g/mol. Its IUPAC name is (Z)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid.
| Compound Name | (Z)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 43839856 |
| Molecular Formula | C13H8Cl2O3S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | (Z)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid |
| SMILES | O=C(O)/C(S)=C/c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C13H8Cl2O3S/c14-7-1-3-9(10(15)5-7)11-4-2-8(18-11)6-12(19)13(16)17/h1-6,19H,(H,16,17)/b12-6- |
| InChIKey | YOOVLMPJMXSZKF-SDQBBNPISA-N |
| XLogP | 4.61 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|