C18H11Cl2NO3 — CID 2911165
2-(2,4-dichlorophenyl)-5-(2-nitro-2-phenylethenyl)furan (PubChem CID 2911165) has the molecular formula C18H11Cl2NO3 and a molecular weight of 360.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-(2-nitro-2-phenylethenyl)furan.
| Compound Name | 2-(2,4-dichlorophenyl)-5-(2-nitro-2-phenylethenyl)furan |
|---|---|
| PubChem CID | 2911165 |
| Molecular Formula | C18H11Cl2NO3 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-(2-nitro-2-phenylethenyl)furan |
| SMILES | O=[N+]([O-])C(=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)c1ccccc1 |
| InChI | InChI=1S/C18H11Cl2NO3/c19-13-6-8-15(16(20)10-13)18-9-7-14(24-18)11-17(21(22)23)12-4-2-1-3-5-12/h1-11H |
| InChIKey | FZIGNAYJFXJJON-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|