C27H20Cl2N2O3 — CID 6241436
N-[(E)-3-(benzylamino)-1-[5-(2,4-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6241436) has the molecular formula C27H20Cl2N2O3 and a molecular weight of 491.37 g/mol. Its IUPAC name is N-[(E)-3-(benzylamino)-1-[5-(2,4-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-(benzylamino)-1-[5-(2,4-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6241436 |
| Molecular Formula | C27H20Cl2N2O3 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[(E)-3-(benzylamino)-1-[5-(2,4-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1ccccc1)/C(=C\c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N2O3/c28-20-11-13-22(23(29)15-20)25-14-12-21(34-25)16-24(31-26(32)19-9-5-2-6-10-19)27(33)30-17-18-7-3-1-4-8-18/h1-16H,17H2,(H,30,33)(H,31,32)/b24-16+ |
| InChIKey | PICLXTCCUKRWGY-LFVJCYFKSA-N |
| XLogP | 6.34 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|