C16H12Cl2O5 — CID 24780934
dimethyl 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]propanedioate (PubChem CID 24780934) has the molecular formula C16H12Cl2O5 and a molecular weight of 355.17 g/mol. Its IUPAC name is dimethyl 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 24780934 |
| Molecular Formula | C16H12Cl2O5 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | dimethyl 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)C(=O)OC |
| InChI | InChI=1S/C16H12Cl2O5/c1-21-15(19)12(16(20)22-2)8-10-4-6-14(23-10)11-5-3-9(17)7-13(11)18/h3-8H,1-2H3 |
| InChIKey | IEGFVYYPWUYXJY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|