C16H12Cl2O4 — CID 22299441
methyl (2E)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-oxobutanoate (PubChem CID 22299441) has the molecular formula C16H12Cl2O4 and a molecular weight of 339.17 g/mol. Its IUPAC name is methyl (2E)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-oxobutanoate.
| Compound Name | methyl (2E)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 22299441 |
| Molecular Formula | C16H12Cl2O4 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | methyl (2E)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-oxobutanoate |
| SMILES | COC(=O)/C(=C/c1ccc(-c2cc(Cl)ccc2Cl)o1)C(C)=O |
| InChI | InChI=1S/C16H12Cl2O4/c1-9(19)12(16(20)21-2)8-11-4-6-15(22-11)13-7-10(17)3-5-14(13)18/h3-8H,1-2H3/b12-8+ |
| InChIKey | HPXNCGHNBVQREM-XYOKQWHBSA-N |
| XLogP | 4.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|