C13H9FO3S — CID 43839852
(Z)-3-[5-(2-fluorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid (PubChem CID 43839852) has the molecular formula C13H9FO3S and a molecular weight of 264.28 g/mol. Its IUPAC name is (Z)-3-[5-(2-fluorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid.
| Compound Name | (Z)-3-[5-(2-fluorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 43839852 |
| Molecular Formula | C13H9FO3S |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (Z)-3-[5-(2-fluorophenyl)furan-2-yl]-2-sulfanylprop-2-enoic acid |
| SMILES | O=C(O)/C(S)=C/c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C13H9FO3S/c14-10-4-2-1-3-9(10)11-6-5-8(17-11)7-12(18)13(15)16/h1-7,18H,(H,15,16)/b12-7- |
| InChIKey | GGPYBQPWKJZEKW-GHXNOFRVSA-N |
| XLogP | 3.44 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|