C20H11FO3 — CID 5015439
2-[[5-(2-fluorophenyl)furan-2-yl]methylidene]indene-1,3-dione (PubChem CID 5015439) has the molecular formula C20H11FO3 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)furan-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-(2-fluorophenyl)furan-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 5015439 |
| Molecular Formula | C20H11FO3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)furan-2-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(-c3ccccc3F)o2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H11FO3/c21-17-8-4-3-7-15(17)18-10-9-12(24-18)11-16-19(22)13-5-1-2-6-14(13)20(16)23/h1-11H |
| InChIKey | OWTQPSDBMCTRKD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|