C14H8FNO2S2 — CID 4665185
5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 4665185) has the molecular formula C14H8FNO2S2 and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | 5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 4665185 |
| Molecular Formula | C14H8FNO2S2 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)C(=Cc2ccc(-c3ccccc3F)o2)S1 |
| InChI | InChI=1S/C14H8FNO2S2/c15-10-4-2-1-3-9(10)11-6-5-8(18-11)7-12-13(19)16-14(17)20-12/h1-7H,(H,16,17,19) |
| InChIKey | OLPGXMSVWWIMSW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|