C15H11NO4S — CID 11580302
(5Z)-5-[[5-(2-methoxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11580302) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is (5Z)-5-[[5-(2-methoxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(2-methoxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11580302 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (5Z)-5-[[5-(2-methoxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccccc1-c1ccc(/C=C2\SC(=O)NC2=O)o1 |
| InChI | InChI=1S/C15H11NO4S/c1-19-11-5-3-2-4-10(11)12-7-6-9(20-12)8-13-14(17)16-15(18)21-13/h2-8H,1H3,(H,16,17,18)/b13-8- |
| InChIKey | KSBRXTQOZDUEGL-JYRVWZFOSA-N |
| XLogP | 3.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|