C15H10BrNO3S — CID 2872145
5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2872145) has the molecular formula C15H10BrNO3S and a molecular weight of 364.22 g/mol. Its IUPAC name is 5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2872145 |
| Molecular Formula | C15H10BrNO3S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(C=C3SC(=O)NC3=O)o2)c(Br)c1 |
| InChI | InChI=1S/C15H10BrNO3S/c1-8-2-4-10(11(16)6-8)12-5-3-9(20-12)7-13-14(18)17-15(19)21-13/h2-7H,1H3,(H,17,18,19) |
| InChIKey | DGKRQVFGMGSFKL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|