C20H12Cl2N2O2S — CID 135782284
(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one (PubChem CID 135782284) has the molecular formula C20H12Cl2N2O2S and a molecular weight of 415.30 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135782284 |
| Molecular Formula | C20H12Cl2N2O2S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=N\c2ccccc2)/C(=C/c2ccc(-c3cccc(Cl)c3Cl)o2)S1 |
| InChI | InChI=1S/C20H12Cl2N2O2S/c21-15-8-4-7-14(18(15)22)16-10-9-13(26-16)11-17-19(24-20(25)27-17)23-12-5-2-1-3-6-12/h1-11H,(H,23,24,25)/b17-11- |
| InChIKey | LDVSZFXICYXCBN-BOPFTXTBSA-N |
| XLogP | 6.78 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|