C21H14Cl2N2O2S — CID 135782299
(5Z)-5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-(3-methylphenyl)imino-1,3-thiazolidin-2-one (PubChem CID 135782299) has the molecular formula C21H14Cl2N2O2S and a molecular weight of 429.33 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-(3-methylphenyl)imino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-(3-methylphenyl)imino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135782299 |
| Molecular Formula | C21H14Cl2N2O2S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | (5Z)-5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-(3-methylphenyl)imino-1,3-thiazolidin-2-one |
| SMILES | Cc1cccc(/N=C2\NC(=O)S\C2=C/c2ccc(-c3c(Cl)cccc3Cl)o2)c1 |
| InChI | InChI=1S/C21H14Cl2N2O2S/c1-12-4-2-5-13(10-12)24-20-18(28-21(26)25-20)11-14-8-9-17(27-14)19-15(22)6-3-7-16(19)23/h2-11H,1H3,(H,24,25,26)/b18-11- |
| InChIKey | LSIUYFNIBFNHKY-WQRHYEAKSA-N |
| XLogP | 7.09 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|