C20H11Cl2FN2O2S — CID 135470203
5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-(4-fluorophenyl)imino-1,3-thiazolidin-2-one (PubChem CID 135470203) has the molecular formula C20H11Cl2FN2O2S and a molecular weight of 433.29 g/mol. Its IUPAC name is 5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-(4-fluorophenyl)imino-1,3-thiazolidin-2-one.
| Compound Name | 5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-(4-fluorophenyl)imino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135470203 |
| Molecular Formula | C20H11Cl2FN2O2S |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-(4-fluorophenyl)imino-1,3-thiazolidin-2-one |
| SMILES | O=C1N/C(=N\c2ccc(F)cc2)C(=Cc2ccc(-c3cc(Cl)cc(Cl)c3)o2)S1 |
| InChI | InChI=1S/C20H11Cl2FN2O2S/c21-12-7-11(8-13(22)9-12)17-6-5-16(27-17)10-18-19(25-20(26)28-18)24-15-3-1-14(23)2-4-15/h1-10H,(H,24,25,26) |
| InChIKey | ZVBLTFJBHCQSJK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|