C20H15N3O4S2 — CID 135498345
4-[5-[(2-oxo-4-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide (PubChem CID 135498345) has the molecular formula C20H15N3O4S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-[5-[(2-oxo-4-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[(2-oxo-4-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135498345 |
| Molecular Formula | C20H15N3O4S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 4-[5-[(2-oxo-4-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(C=C3SC(=O)N/C3=N\c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C20H15N3O4S2/c21-29(25,26)16-9-6-13(7-10-16)17-11-8-15(27-17)12-18-19(23-20(24)28-18)22-14-4-2-1-3-5-14/h1-12H,(H2,21,25,26)(H,22,23,24) |
| InChIKey | NXDRMUYARGALQO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|