C20H21N3O3S2 — CID 135711742
4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzenesulfonamide (PubChem CID 135711742) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 135711742 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(/C=C2\SC(=O)N\C2=N/c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-20(2,3)14-6-4-13(5-7-14)12-17-18(23-19(24)27-17)22-15-8-10-16(11-9-15)28(21,25)26/h4-12H,1-3H3,(H2,21,25,26)(H,22,23,24)/b17-12- |
| InChIKey | XAHRRRUVDLPXAV-ATVHPVEESA-N |
| XLogP | 4.16 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|