C23H24N2O3S — CID 135711687
ethyl 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate (PubChem CID 135711687) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135711687 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\NC(=O)S\C2=C/c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-5-28-21(26)16-8-12-18(13-9-16)24-20-19(29-22(27)25-20)14-15-6-10-17(11-7-15)23(2,3)4/h6-14H,5H2,1-4H3,(H,24,25,27)/b19-14- |
| InChIKey | DNOCOVPNKCJWEA-RGEXLXHISA-N |
| XLogP | 5.69 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|