C16H11FN2O2S — CID 135555338
(5Z)-5-[(4-fluorophenyl)methylidene]-4-(4-hydroxyphenyl)imino-1,3-thiazolidin-2-one (PubChem CID 135555338) has the molecular formula C16H11FN2O2S and a molecular weight of 314.34 g/mol. Its IUPAC name is (5Z)-5-[(4-fluorophenyl)methylidene]-4-(4-hydroxyphenyl)imino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[(4-fluorophenyl)methylidene]-4-(4-hydroxyphenyl)imino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135555338 |
| Molecular Formula | C16H11FN2O2S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (5Z)-5-[(4-fluorophenyl)methylidene]-4-(4-hydroxyphenyl)imino-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=N\c2ccc(O)cc2)/C(=C/c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C16H11FN2O2S/c17-11-3-1-10(2-4-11)9-14-15(19-16(21)22-14)18-12-5-7-13(20)8-6-12/h1-9,20H,(H,18,19,21)/b14-9- |
| InChIKey | IMDHDLMMZMEBDH-ZROIWOOFSA-N |
| XLogP | 4.06 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|