C15H9F2N3OS — CID 135635357
(5E)-4-(3,4-difluorophenyl)imino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-2-one (PubChem CID 135635357) has the molecular formula C15H9F2N3OS and a molecular weight of 317.32 g/mol. Its IUPAC name is (5E)-4-(3,4-difluorophenyl)imino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-2-one.
| Compound Name | (5E)-4-(3,4-difluorophenyl)imino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135635357 |
| Molecular Formula | C15H9F2N3OS |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (5E)-4-(3,4-difluorophenyl)imino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=N\c2ccc(F)c(F)c2)/C(=C\c2ccncc2)S1 |
| InChI | InChI=1S/C15H9F2N3OS/c16-11-2-1-10(8-12(11)17)19-14-13(22-15(21)20-14)7-9-3-5-18-6-4-9/h1-8H,(H,19,20,21)/b13-7+ |
| InChIKey | PNSWEDHTYHAXOH-NTUHNPAUSA-N |
| XLogP | 3.89 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|