C20H13FN4O2S — CID 135635383
(5E)-4-(3-fluorophenyl)imino-5-[(3-pyrimidin-2-yloxyphenyl)methylidene]-1,3-thiazolidin-2-one (PubChem CID 135635383) has the molecular formula C20H13FN4O2S and a molecular weight of 392.42 g/mol. Its IUPAC name is (5E)-4-(3-fluorophenyl)imino-5-[(3-pyrimidin-2-yloxyphenyl)methylidene]-1,3-thiazolidin-2-one.
| Compound Name | (5E)-4-(3-fluorophenyl)imino-5-[(3-pyrimidin-2-yloxyphenyl)methylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135635383 |
| Molecular Formula | C20H13FN4O2S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (5E)-4-(3-fluorophenyl)imino-5-[(3-pyrimidin-2-yloxyphenyl)methylidene]-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=N\c2cccc(F)c2)/C(=C\c2cccc(Oc3ncccn3)c2)S1 |
| InChI | InChI=1S/C20H13FN4O2S/c21-14-5-2-6-15(12-14)24-18-17(28-20(26)25-18)11-13-4-1-7-16(10-13)27-19-22-8-3-9-23-19/h1-12H,(H,24,25,26)/b17-11+ |
| InChIKey | JPHKCDWABNBNGL-GZTJUZNOSA-N |
| XLogP | 4.94 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|