C20H21FN4O3S2 — CID 136899522
(5Z)-5-[[3,5-dimethyl-1-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]pyrazol-4-yl]methylidene]-4-(3-fluorophenyl)imino-1,3-thiazolidin-2-one (PubChem CID 136899522) has the molecular formula C20H21FN4O3S2 and a molecular weight of 448.55 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dimethyl-1-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]pyrazol-4-yl]methylidene]-4-(3-fluorophenyl)imino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[3,5-dimethyl-1-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]pyrazol-4-yl]methylidene]-4-(3-fluorophenyl)imino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 136899522 |
| Molecular Formula | C20H21FN4O3S2 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (5Z)-5-[[3,5-dimethyl-1-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]pyrazol-4-yl]methylidene]-4-(3-fluorophenyl)imino-1,3-thiazolidin-2-one |
| SMILES | Cc1nn([C@]2(C)CCS(=O)(=O)C2)c(C)c1/C=C1\SC(=O)N\C1=N/c1cccc(F)c1 |
| InChI | InChI=1S/C20H21FN4O3S2/c1-12-16(13(2)25(24-12)20(3)7-8-30(27,28)11-20)10-17-18(23-19(26)29-17)22-15-6-4-5-14(21)9-15/h4-6,9-10H,7-8,11H2,1-3H3,(H,22,23,26)/b17-10-/t20-/m1/s1 |
| InChIKey | SKGUSYRUEPPELL-PLMLNFJUSA-N |
| XLogP | 3.70 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|