C20H22N4O4S2 — CID 136899529
(5Z)-5-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-4-(3-methoxyphenyl)imino-1,3-thiazolidin-2-one (PubChem CID 136899529) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is (5Z)-5-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-4-(3-methoxyphenyl)imino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-4-(3-methoxyphenyl)imino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 136899529 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (5Z)-5-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-4-(3-methoxyphenyl)imino-1,3-thiazolidin-2-one |
| SMILES | COc1cccc(/N=C2\NC(=O)S\C2=C/c2c(C)nn([C@H]3CCS(=O)(=O)C3)c2C)c1 |
| InChI | InChI=1S/C20H22N4O4S2/c1-12-17(13(2)24(23-12)15-7-8-30(26,27)11-15)10-18-19(22-20(25)29-18)21-14-5-4-6-16(9-14)28-3/h4-6,9-10,15H,7-8,11H2,1-3H3,(H,21,22,25)/b18-10-/t15-/m0/s1 |
| InChIKey | PGPRIQRGRSAQGR-PACYTGELSA-N |
| XLogP | 3.40 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|