C19H21N3O3S — CID 9188093
(3Z)-3-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1-methylindol-2-one (PubChem CID 9188093) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is (3Z)-3-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-3-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 9188093 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (3Z)-3-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1-methylindol-2-one |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=C1\C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O3S/c1-12-16(13(2)22(20-12)14-8-9-26(24,25)11-14)10-17-15-6-4-5-7-18(15)21(3)19(17)23/h4-7,10,14H,8-9,11H2,1-3H3/b17-10-/t14-/m1/s1 |
| InChIKey | RFBQOWHBLFGMLU-AYCSXLNKSA-N |
| XLogP | 2.38 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|