C18H19N5O3S2 — CID 45115458
3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 45115458) has the molecular formula C18H19N5O3S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 45115458 |
| Molecular Formula | C18H19N5O3S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C=Nn1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C18H19N5O3S2/c1-11-15(12(2)22(21-11)13-7-8-28(25,26)10-13)9-19-23-17(24)14-5-3-4-6-16(14)20-18(23)27/h3-6,9,13H,7-8,10H2,1-2H3,(H,20,27)/t13-/m0/s1 |
| InChIKey | DMGUQTIDUKOLIU-ZDUSSCGKSA-N |
| XLogP | 2.11 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|