C17H20FN5O2S2 — CID 9144023
1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea (PubChem CID 9144023) has the molecular formula C17H20FN5O2S2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9144023 |
| Molecular Formula | C17H20FN5O2S2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\NC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C17H20FN5O2S2/c1-11-14(12(2)23(22-11)13-7-8-27(24,25)10-13)9-19-21-17(26)20-16-6-4-3-5-15(16)18/h3-6,9,13H,7-8,10H2,1-2H3,(H2,20,21,26)/b19-9-/t13-/m1/s1 |
| InChIKey | URSNJMGGWDYVOI-JFPGXGMNSA-N |
| XLogP | 2.32 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|