C14H23N5O2S2 — CID 9146022
1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-propan-2-ylthiourea (PubChem CID 9146022) has the molecular formula C14H23N5O2S2 and a molecular weight of 357.51 g/mol. Its IUPAC name is 1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-propan-2-ylthiourea.
| Compound Name | 1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 9146022 |
| Molecular Formula | C14H23N5O2S2 |
| Molecular Weight | 357.51 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-propan-2-ylthiourea |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\NC(=S)NC(C)C |
| InChI | InChI=1S/C14H23N5O2S2/c1-9(2)16-14(22)17-15-7-13-10(3)18-19(11(13)4)12-5-6-23(20,21)8-12/h7,9,12H,5-6,8H2,1-4H3,(H2,16,17,22)/b15-7-/t12-/m1/s1 |
| InChIKey | TVCCGSAZVHHDQH-FKZYXTMDSA-N |
| XLogP | 1.07 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.51 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|