C18H21FN4O3S — CID 9153502
N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 9153502) has the molecular formula C18H21FN4O3S and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9153502 |
| Molecular Formula | C18H21FN4O3S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN4O3S/c1-12-17(13(2)23(22-12)16-7-8-27(25,26)11-16)10-20-21-18(24)9-14-3-5-15(19)6-4-14/h3-6,10,16H,7-9,11H2,1-2H3,(H,21,24)/b20-10-/t16-/m1/s1 |
| InChIKey | NTNOYPZEPHDRBU-HSGPEQJXSA-N |
| XLogP | 1.69 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|