C16H19N5O3S — CID 9142879
N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridine-3-carboxamide (PubChem CID 9142879) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9142879 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridine-3-carboxamide |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1/C=N\NC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H19N5O3S/c1-11-15(9-18-19-16(22)13-4-3-6-17-8-13)12(2)21(20-11)14-5-7-25(23,24)10-14/h3-4,6,8-9,14H,5,7,10H2,1-2H3,(H,19,22)/b18-9-/t14-/m0/s1 |
| InChIKey | LSPKPWQCRFBNST-WXARJGPPSA-N |
| XLogP | 1.02 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|