C17H19ClN4O3S — CID 9142909
4-chloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 9142909) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9142909 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-chloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-11-16(9-19-20-17(23)13-3-5-14(18)6-4-13)12(2)22(21-11)15-7-8-26(24,25)10-15/h3-6,9,15H,7-8,10H2,1-2H3,(H,20,23)/b19-9-/t15-/m1/s1 |
| InChIKey | WUYPCOSZTCUTIC-HBFFOVPNSA-N |
| XLogP | 2.28 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|