C16H19FN4O2S — CID 9143080
N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-fluoroaniline (PubChem CID 9143080) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-fluoroaniline.
| Compound Name | N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-fluoroaniline |
|---|---|
| PubChem CID | 9143080 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-fluoroaniline |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN4O2S/c1-11-16(9-18-19-14-5-3-13(17)4-6-14)12(2)21(20-11)15-7-8-24(22,23)10-15/h3-6,9,15,19H,7-8,10H2,1-2H3/b18-9-/t15-/m1/s1 |
| InChIKey | OPCKLAYUVWPPSU-FNMPFJKNSA-N |
| XLogP | 2.44 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|