C15H17Cl2N5O2S — CID 9150319
3,5-dichloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridin-2-amine (PubChem CID 9150319) has the molecular formula C15H17Cl2N5O2S and a molecular weight of 402.31 g/mol. Its IUPAC name is 3,5-dichloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 9150319 |
| Molecular Formula | C15H17Cl2N5O2S |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 3,5-dichloro-N-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]pyridin-2-amine |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2N5O2S/c1-9-13(7-19-20-15-14(17)5-11(16)6-18-15)10(2)22(21-9)12-3-4-25(23,24)8-12/h5-7,12H,3-4,8H2,1-2H3,(H,18,20)/b19-7-/t12-/m1/s1 |
| InChIKey | VTOKLYLBJCXAJD-BSXPZDSASA-N |
| XLogP | 3.01 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|