C14H16ClN5O2S — CID 9121687
N-[(Z)-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]pyridin-2-amine (PubChem CID 9121687) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]pyridin-2-amine.
| Compound Name | N-[(Z)-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 9121687 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[(Z)-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]pyridin-2-amine |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(Cl)c1/C=N\Nc1ccccn1 |
| InChI | InChI=1S/C14H16ClN5O2S/c1-10-12(8-17-18-13-4-2-3-6-16-13)14(15)20(19-10)11-5-7-23(21,22)9-11/h2-4,6,8,11H,5,7,9H2,1H3,(H,16,18)/b17-8-/t11-/m0/s1 |
| InChIKey | GKYXDADAQAIUOL-FQKVVYMKSA-N |
| XLogP | 2.05 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|