C15H19ClN6O2S — CID 9013478
N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 9013478) has the molecular formula C15H19ClN6O2S and a molecular weight of 382.88 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 9013478 |
| Molecular Formula | C15H19ClN6O2S |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N/N=C\c2c(C)nn([C@@H]3CCS(=O)(=O)C3)c2Cl)n1 |
| InChI | InChI=1S/C15H19ClN6O2S/c1-9-6-10(2)19-15(18-9)20-17-7-13-11(3)21-22(14(13)16)12-4-5-25(23,24)8-12/h6-7,12H,4-5,8H2,1-3H3,(H,18,19,20)/b17-7-/t12-/m1/s1 |
| InChIKey | XCWJKMSKKOLPCK-JGSGYBEMSA-N |
| XLogP | 2.06 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|