C16H16ClN5O2S — CID 9023853
(Z)-N-(benzimidazol-1-yl)-1-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methanimine (PubChem CID 9023853) has the molecular formula C16H16ClN5O2S and a molecular weight of 377.86 g/mol. Its IUPAC name is (Z)-N-(benzimidazol-1-yl)-1-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methanimine.
| Compound Name | (Z)-N-(benzimidazol-1-yl)-1-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 9023853 |
| Molecular Formula | C16H16ClN5O2S |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (Z)-N-(benzimidazol-1-yl)-1-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methanimine |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(Cl)c1/C=N\n1cnc2ccccc21 |
| InChI | InChI=1S/C16H16ClN5O2S/c1-11-13(8-19-21-10-18-14-4-2-3-5-15(14)21)16(17)22(20-11)12-6-7-25(23,24)9-12/h2-5,8,10,12H,6-7,9H2,1H3/b19-8-/t12-/m0/s1 |
| InChIKey | UOHCIGHOKPLUQF-SEAWGRMISA-N |
| XLogP | 2.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|