C15H16Cl2N4O2S — CID 9076548
3-chloro-N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]aniline (PubChem CID 9076548) has the molecular formula C15H16Cl2N4O2S and a molecular weight of 387.29 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]aniline.
| Compound Name | 3-chloro-N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 9076548 |
| Molecular Formula | C15H16Cl2N4O2S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 3-chloro-N-[(Z)-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylideneamino]aniline |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(Cl)c1/C=N\Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N4O2S/c1-10-14(8-18-19-12-4-2-3-11(16)7-12)15(17)21(20-10)13-5-6-24(22,23)9-13/h2-4,7-8,13,19H,5-6,9H2,1H3/b18-8-/t13-/m1/s1 |
| InChIKey | YISTZWLKHWXTDF-KURMNSRBSA-N |
| XLogP | 3.30 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|