C16H19N5O4S — CID 9143233
N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-nitroaniline (PubChem CID 9143233) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-nitroaniline.
| Compound Name | N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-nitroaniline |
|---|---|
| PubChem CID | 9143233 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-nitroaniline |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1/C=N\Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N5O4S/c1-11-16(9-17-18-13-4-3-5-14(8-13)21(22)23)12(2)20(19-11)15-6-7-26(24,25)10-15/h3-5,8-9,15,18H,6-7,10H2,1-2H3/b17-9-/t15-/m0/s1 |
| InChIKey | SVVHSQJPMKHUGN-MBBOSUJBSA-N |
| XLogP | 2.21 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|